|
CAS#: 72927-89-0 Product: 3,3,5,5-Tetramethyl-4,4A,6,7-Tetrahydro-1H-Naphthalen-2-One No suppilers available for the product. |
| Name | 3,3,5,5-Tetramethyl-4,4A,6,7-Tetrahydro-1H-Naphthalen-2-One |
|---|---|
| Synonyms | 2(1H)-Naphthalenone, 3,4,4A,5,6,7-Hexahydro-3,3,5,5-Tetramethyl-; 3,4,4A,5,6,7-Hexahydro-3,3,5,5-Tetramethylnaphthalene-2(1H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 72927-89-0 |
| EINECS | 277-030-8 |
| SMILES | CC1(C2C(=CCC1)CC(=O)C(C2)(C)C)C |
| InChI | 1S/C14H22O/c1-13(2)7-5-6-10-8-12(15)14(3,4)9-11(10)13/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | MNMIFQQWGUTOBE-UHFFFAOYSA-N |
| Density | 0.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.311°C at 760 mmHg (Cal.) |
| Flash point | 115.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,5,5-Tetramethyl-4,4A,6,7-Tetrahydro-1H-Naphthalen-2-One |