|
CAS#: 72928-23-5 Product: 1-[4-Methyl-5-(3-Methylbut-2-Enyl)-1-Cyclohex-3-Enyl]Ethanone No suppilers available for the product. |
| Name | 1-[4-Methyl-5-(3-Methylbut-2-Enyl)-1-Cyclohex-3-Enyl]Ethanone |
|---|---|
| Synonyms | 1-(4-Methyl-5-(3-Methyl-2-Butenyl)-3-Cyclohexen-1-Yl)Ethan-1-One; 2-(4-Methyl-5-(3-Methyl-2-Butenyl)-3-Cyclohexen-1-Yl)Ethan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 72928-23-5 |
| EINECS | 277-057-5 |
| SMILES | C(C=C(C)C)C1C(=CCC(C(=O)C)C1)C |
| InChI | 1S/C14H22O/c1-10(2)5-7-13-9-14(12(4)15)8-6-11(13)3/h5-6,13-14H,7-9H2,1-4H3 |
| InChIKey | AAKUUHILWZWNCL-UHFFFAOYSA-N |
| Density | 0.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.635°C at 760 mmHg (Cal.) |
| Flash point | 114.36°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-Methyl-5-(3-Methylbut-2-Enyl)-1-Cyclohex-3-Enyl]Ethanone |