|
CAS#: 72945-11-0 Product: (2E,4E)-2,4-Dichlorohexa-2,4-Dienedioic Acid No suppilers available for the product. |
| Name | (2E,4E)-2,4-Dichlorohexa-2,4-Dienedioic Acid |
|---|---|
| Synonyms | (E,E)-2,4-Dichloro-2,4-Hexadienedioic Acid; 2,4-Dichloro-Cis,Cis-Muconic Acid; Chebi:17365 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4Cl2O4 |
| Molecular Weight | 211.00 |
| CAS Registry Number | 72945-11-0 |
| SMILES | O=C(O)\C(Cl)=C/C(Cl)=C\C(O)=O |
| InChI | 1S/C6H4Cl2O4/c7-3(2-5(9)10)1-4(8)6(11)12/h1-2H,(H,9,10)(H,11,12)/b3-2+,4-1+ |
| InChIKey | FHXOPKKNGKBBKG-DXLKSGPOSA-N |
| Density | 1.669g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.483°C at 760 mmHg (Cal.) |
| Flash point | 138.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E,4E)-2,4-Dichlorohexa-2,4-Dienedioic Acid |