|
CAS#: 72987-33-8 Product: (2-Methyl-1,3-Benzoxazol-6-Yl)-Phenylmethanone No suppilers available for the product. |
| Name | (2-Methyl-1,3-Benzoxazol-6-Yl)-Phenylmethanone |
|---|---|
| Synonyms | (2-Methyl-1,3-Benzoxazol-6-Yl)-Phenyl-Methanone; 2-Methyl-6-Benzoxazol-1-Yl Phenyl Ketone; 2-Methyl-6-Benzoylbenzoxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 72987-33-8 |
| EINECS | 277-182-5 |
| SMILES | C1=C(C=CC2=C1OC(=N2)C)C(=O)C3=CC=CC=C3 |
| InChI | 1S/C15H11NO2/c1-10-16-13-8-7-12(9-14(13)18-10)15(17)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | OMYCUQIDXCNEHW-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.472°C at 760 mmHg (Cal.) |
| Flash point | 184.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Methyl-1,3-Benzoxazol-6-Yl)-Phenylmethanone |