|
CAS#: 7299-93-6 Product: Butyl Ethyl 1,2-Benzenedicarboxylate No suppilers available for the product. |
| Name | Butyl Ethyl 1,2-Benzenedicarboxylate |
|---|---|
| Synonyms | 3-(1-Methylpentyl)Phthalate; 1,2-Benzenedicarboxylic Acid, Butyl Ethyl Ester; Butylethylphthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 7299-93-6 |
| SMILES | C1=C(C(=C(C([O-])=O)C=C1)C([O-])=O)C(CCCC)C |
| InChI | 1S/C14H18O4/c1-3-4-6-9(2)10-7-5-8-11(13(15)16)12(10)14(17)18/h5,7-9H,3-4,6H2,1-2H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | FXDOVRMGVMGGPZ-UHFFFAOYSA-L |
| Boiling point | 404.172°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl Ethyl 1,2-Benzenedicarboxylate |