|
CAS#: 72994-16-2 Product: 1',4',5',7,8'-Pentabromo-3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-2',7'-dicarboxylic acid No suppilers available for the product. |
| Name | 1',4',5',7,8'-Pentabromo-3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-2',7'-dicarboxylic acid |
|---|---|
| Synonyms | 9/7/6359 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H7Br5O9 |
| Molecular Weight | 814.81 |
| CAS Registry Number | 72994-16-2 |
| SMILES | c1cc2c(c(c1)Br)C3(c4c(c(c(c(c4Br)C(=O)O)O)Br)Oc5c3c(c(c(c5Br)O)C(=O)O)Br)OC2=O |
| InChI | 1S/C22H7Br5O9/c23-5-3-1-2-4-8(5)22(36-21(4)34)9-11(24)6(19(30)31)15(28)13(26)17(9)35-18-10(22)12(25)7(20(32)33)16(29)14(18)27/h1-3,28-29H,(H,30,31)(H,32,33) |
| InChIKey | VFBZCUACIBONPC-UHFFFAOYSA-N |
| Density | 2.805g/cm3 (Cal.) |
|---|---|
| Boiling point | 822.477°C at 760 mmHg (Cal.) |
| Flash point | 451.218°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1',4',5',7,8'-Pentabromo-3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-2',7'-dicarboxylic acid |