|
CAS#: 73009-82-2 Product: 6,7-Diphenyl-2,3-Dihydro-1H-Pyrrolizine No suppilers available for the product. |
| Name | 6,7-Diphenyl-2,3-Dihydro-1H-Pyrrolizine |
|---|---|
| Synonyms | Dadhp; 1H-Pyrrolizine, 2,3-Dihydro-6,7-Diphenyl-; 2,3-Dihydro-6,7-Diphenyl-1H-Pyrrolizine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 |
| CAS Registry Number | 73009-82-2 |
| SMILES | C1=C(C(=C2[N]1CCC2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C19H17N/c1-3-8-15(9-4-1)17-14-20-13-7-12-18(20)19(17)16-10-5-2-6-11-16/h1-6,8-11,14H,7,12-13H2 |
| InChIKey | KTNZDKBUNJCAGR-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.364°C at 760 mmHg (Cal.) |
| Flash point | 205.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Diphenyl-2,3-Dihydro-1H-Pyrrolizine |