|
CAS#: 73143-90-5 Product: 1-(4-Chlorophenoxy)-4-Nitrosobenzene No suppilers available for the product. |
| Name | 1-(4-Chlorophenoxy)-4-Nitrosobenzene |
|---|---|
| Synonyms | 1-(4-Chlorophenoxy)-4-Nitroso-Benzene; 1-Chloro-4-(4-Nitrosophenoxy)Benzene; 4'-Chloro-4-Nitrosobiphenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.65 |
| CAS Registry Number | 73143-90-5 |
| SMILES | C2=C(OC1=CC=C(Cl)C=C1)C=CC(=C2)N=O |
| InChI | 1S/C12H8ClNO2/c13-9-1-5-11(6-2-9)16-12-7-3-10(14-15)4-8-12/h1-8H |
| InChIKey | MPUBELFDJUTMHR-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.971°C at 760 mmHg (Cal.) |
| Flash point | 161.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenoxy)-4-Nitrosobenzene |