|
CAS#: 73211-11-7 Product: Isodon Shikokianus, Compound A No suppilers available for the product. |
| Name | Isodon Shikokianus, Compound A |
|---|---|
| Synonyms | Isodon Shikokianus Compound A; Nsc302979; Shikoccin |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| CAS Registry Number | 73211-11-7 |
| SMILES | CC1(C2C(CCC1OC(=O)C)(C(=O)CCC3C=C(C(O)C2)C(=O)C3=C)C)C |
| InChI | 1S/C22H30O5/c1-12-14-6-7-18(25)22(5)9-8-19(27-13(2)23)21(3,4)17(22)11-16(24)15(10-14)20(12)26/h10,14,16-17,19,24H,1,6-9,11H2,2-5H3 |
| InChIKey | SZAHIEIJJDKFRX-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.692°C at 760 mmHg (Cal.) |
| Flash point | 178.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isodon Shikokianus, Compound A |