|
CAS#: 73243-10-4 Product: 4-S-Cysteinylphenol No suppilers available for the product. |
| Name | 4-S-Cysteinylphenol |
|---|---|
| Synonyms | (2R)-2-Amino-3-(4-Hydroxyphenyl)Sulfanyl-Propanoic Acid; (2R)-2-Amino-3-[(4-Hydroxyphenyl)Thio]Propanoic Acid; (2R)-2-Amino-3-[(4-Hydroxyphenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.25 |
| CAS Registry Number | 73243-10-4 |
| SMILES | [C@H](C(=O)O)(N)CSC1=CC=C(C=C1)O |
| InChI | 1S/C9H11NO3S/c10-8(9(12)13)5-14-7-3-1-6(11)2-4-7/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | FVXLRXHSPYGEFL-QMMMGPOBSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.708°C at 760 mmHg (Cal.) |
| Flash point | 216.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-S-Cysteinylphenol |