|
CAS#: 73270-47-0 Product: 2-amino-5-ethoxy-5-oxo-Pentanoate hydrochloride (1:1) No suppilers available for the product. |
| Name | 2-amino-5-ethoxy-5-oxo-Pentanoate hydrochloride (1:1) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H13ClNO4 |
| Molecular Weight | 210.64 |
| CAS Registry Number | 73270-47-0 |
| EINECS | 277-337-7 |
| SMILES | Cl.NC(CCC(=O)OCC)C([O-])=O |
| InChI | 1S/C7H13NO4.ClH/c1-2-12-6(9)4-3-5(8)7(10)11;/h5H,2-4,8H2,1H3,(H,10,11);1H/p-1 |
| InChIKey | JEDUWQDSBRHBIP-UHFFFAOYSA-M |
| Boiling point | 355.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-amino-5-ethoxy-5-oxo-Pentanoate hydrochloride (1:1) |