|
CAS#: 7329-04-6 Product: 1,2,3,4,4a,5,8,8a-Octahydro-1,4:5,8-Dimethanonaphthalene-2-Methanol No suppilers available for the product. |
| Name | 1,2,3,4,4a,5,8,8a-Octahydro-1,4:5,8-Dimethanonaphthalene-2-Methanol |
|---|---|
| Synonyms | 1,4:5,8-Dimethanonaphthalene-2-Methanol, 1,2,3,4,4A,5,8,8A-Octahydro-; Ai3-08983 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 7329-04-6 |
| EINECS | 230-821-1 |
| SMILES | C(C4C3C2C1C=CC(C1)C2C(C3)C4)O |
| InChI | 1S/C13H18O/c14-6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13/h1-2,7-14H,3-6H2 |
| InChIKey | LLPLOWFYJGZIBV-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.226°C at 760 mmHg (Cal.) |
| Flash point | 128.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,4a,5,8,8a-Octahydro-1,4:5,8-Dimethanonaphthalene-2-Methanol |