|
CAS#: 73323-33-8 Product: N'-(6,11-Dimethyl-5H-Pyrido(3',4':4,5)Pyrrolo(2,3-g)Isoquinolin-10-Yl)-N,N-Diethyl-1,3-Propanediamine No suppilers available for the product. |
| Name | N'-(6,11-Dimethyl-5H-Pyrido(3',4':4,5)Pyrrolo(2,3-g)Isoquinolin-10-Yl)-N,N-Diethyl-1,3-Propanediamine |
|---|---|
| Synonyms | 1-(Gamma-Diethylaminopropylamino)-5,11-Dimethyl-6H-Dipyrido(4,3-B)(3,4-F)Indole [French]; Brn 4569515 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 |
| CAS Registry Number | 73323-33-8 |
| SMILES | C1=NC(=C2C(=C1)C(=C4C(=C2C)C3=CN=CC=C3[NH]4)C)NCCCN(CC)CC |
| InChI | 1S/C23H29N5/c1-5-28(6-2)13-7-10-25-23-21-16(4)20-18-14-24-11-9-19(18)27-22(20)15(3)17(21)8-12-26-23/h8-9,11-12,14,27H,5-7,10,13H2,1-4H3,(H,25,26) |
| InChIKey | LKRRNQQFDSLVKT-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.816°C at 760 mmHg (Cal.) |
| Flash point | 328.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(6,11-Dimethyl-5H-Pyrido(3',4':4,5)Pyrrolo(2,3-g)Isoquinolin-10-Yl)-N,N-Diethyl-1,3-Propanediamine |