|
CAS#: 7334-23-8 Product: 4-((4-Arsonophenyl)diazenyl)phenylarsonic acid No suppilers available for the product. |
| Name | 4-((4-Arsonophenyl)diazenyl)phenylarsonic acid |
|---|---|
| Synonyms | [4-(4-Arsonophenyl)Azophenyl]Arsonic Acid; Arsonic Acid, (Azodi-4,1-Phenylene)Bis-; Azophenylarsonate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12As2N2O6 |
| Molecular Weight | 430.08 |
| CAS Registry Number | 7334-23-8 |
| SMILES | C1=C([As](O)(O)=O)C=CC(=C1)N=NC2=CC=C(C=C2)[As](O)(O)=O |
| InChI | 1S/C12H12As2N2O6/c17-13(18,19)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(20,21)22/h1-8H,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | ITRMROGJSNWFKO-UHFFFAOYSA-N |
| Boiling point | 813.259°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 445.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-((4-Arsonophenyl)diazenyl)phenylarsonic acid |