|
CAS#: 7338-49-0 Product: 5-(4-Methyl-2-pentanylidene)-1,3-cyclopentadiene No suppilers available for the product. |
| Name | 5-(4-Methyl-2-pentanylidene)-1,3-cyclopentadiene |
|---|---|
| Synonyms | 5-(1,3-Dimethylbutylidene)-1,3-cyclopentadiene # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.24 |
| CAS Registry Number | 7338-49-0 |
| SMILES | C(=C1/C=C\C=C1)(\CC(C)C)C |
| InChI | 1S/C11H16/c1-9(2)8-10(3)11-6-4-5-7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | MXGVTEAVEDFATH-UHFFFAOYSA-N |
| Density | 0.887g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.558°C at 760 mmHg (Cal.) |
| Flash point | 64.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Methyl-2-pentanylidene)-1,3-cyclopentadiene |