|
CAS#: 73398-86-4 Product: 4-(3-Chloro-5-Propylphenyl)-Pyridine No suppilers available for the product. |
| Name | 4-(3-Chloro-5-Propylphenyl)-Pyridine |
|---|---|
| Synonyms | 4-(3-Chloro-5-Propyl-Phenyl)Pyridine; 1-(5-Chloro-3-Pyridylphenyl)Propane; Pyridine, 4-(3-Chloro-5-Propylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.72 |
| CAS Registry Number | 73398-86-4 |
| SMILES | C1=C(C=C(C=C1CCC)Cl)C2=CC=NC=C2 |
| InChI | 1S/C14H14ClN/c1-2-3-11-8-13(10-14(15)9-11)12-4-6-16-7-5-12/h4-10H,2-3H2,1H3 |
| InChIKey | QJNFCQKHQJMVAZ-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.051°C at 760 mmHg (Cal.) |
| Flash point | 186.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Chloro-5-Propylphenyl)-Pyridine |