|
CAS#: 7343-06-8 Product: 3,4,5,6-tetramethyl-Phenanthrene No suppilers available for the product. |
| Name | 3,4,5,6-tetramethyl-Phenanthrene |
|---|---|
| Synonyms | Phenanthrene, 3,4,5,6-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 7343-06-8 |
| SMILES | C2=C(C(=C1C3=C(C=CC1=C2)C=CC(=C3C)C)C)C |
| InChI | 1S/C18H18/c1-11-5-7-15-9-10-16-8-6-12(2)14(4)18(16)17(15)13(11)3/h5-10H,1-4H3 |
| InChIKey | BUSLHLOSCTVNRQ-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.315°C at 760 mmHg (Cal.) |
| Flash point | 194.91°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-tetramethyl-Phenanthrene |