|
CAS#: 73529-24-5 Product: 2-Pyren-4-Yloxirane No suppilers available for the product. |
| Name | 2-Pyren-4-Yloxirane |
|---|---|
| Synonyms | 2-(4-Pyrenyl)Oxirane; 4-Pyrenyloxirane; Brn 4449634 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 73529-24-5 |
| SMILES | C1=C5C4=C3C(=C1C2OC2)C=CC=C3C=CC4=CC=C5 |
| InChI | 1S/C18H12O/c1-3-11-7-8-12-4-2-6-14-15(16-10-19-16)9-13(5-1)17(11)18(12)14/h1-9,16H,10H2 |
| InChIKey | ZPLRRRIERPCHAT-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.437°C at 760 mmHg (Cal.) |
| Flash point | 215.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Pyren-4-Yloxirane |