|
CAS#: 73561-91-8 Product: Janthitrem C No suppilers available for the product. |
| Name | Janthitrem C |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C37H47NO4 |
| Molecular Weight | 569.78 |
| CAS Registry Number | 73561-91-8 |
| SMILES | [C@]34([C@@]2([C@](O)(C1=C[C@@H](O)[C@H](O[C@H]1CC2)C(=C)C)CC[C@H]3CC5=C4[NH]C6=CC7=C(C=C56)C[C@H]8C7=CC(OC8(C)C)(C)C)C)C |
| InChI | 1S/C37H47NO4/c1-19(2)31-29(39)17-27-30(41-31)10-11-35(7)36(8)21(9-12-37(27,35)40)15-24-23-13-20-14-26-25(18-33(3,4)42-34(26,5)6)22(20)16-28(23)38-32(24)36/h13,16-18,21,26,29-31,38-40H,1,9-12,14-15H2,2-8H3/t21-,26-,29+,30-,31+,35+,36+,37+/m0/s1 |
| InChIKey | HVLXXQDJGPKVMK-NCVKUBNTSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 715.02°C at 760 mmHg (Cal.) |
| Flash point | 386.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Janthitrem C |