|
CAS#: 73607-00-8 Product: 1-(2,7-Naphthyridin-3-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(2,7-Naphthyridin-3-Yl)Ethanone |
|---|---|
| Synonyms | 2,7-Naphthyridine-3-Methylketone; 3-Acetyl-2,7-Naphthyridine; Ethanone, 1-(2,7-Naphthyridin-3-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 |
| CAS Registry Number | 73607-00-8 |
| SMILES | C1=C(N=CC2=C1C=CN=C2)C(=O)C |
| InChI | 1S/C10H8N2O/c1-7(13)10-4-8-2-3-11-5-9(8)6-12-10/h2-6H,1H3 |
| InChIKey | VBBXXOOMKKQNNS-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.663°C at 760 mmHg (Cal.) |
| Flash point | 166.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,7-Naphthyridin-3-Yl)Ethanone |