|
CAS#: 736131-01-4 Product: 3-Amino-4-(1H-indol-3-yl)butanoic acid No suppilers available for the product. |
| Name | 3-Amino-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| Synonyms | 3-Amino-4-(1H-indol-3-yl)-butyric acid; 4-(indol-3-yl)-DL-β-homoalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 736131-01-4 |
| SMILES | O=C(O)CC(N)Cc2c1ccccc1nc2 |
| InChI | 1S/C12H14N2O2/c13-9(6-12(15)16)5-8-7-14-11-4-2-1-3-10(8)11/h1-4,7,9,14H,5-6,13H2,(H,15,16) |
| InChIKey | DUVVFMLAHWNDJD-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.255°C at 760 mmHg (Cal.) |
| Flash point | 233.363°C (Cal.) |
| Refractive index | 1.673 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-4-(1H-indol-3-yl)butanoic acid |