|
CAS#: 73622-76-1 Product: 1-(4-Acetylnaphthalen-1-Yl)Oxybutan-2-One No suppilers available for the product. |
| Name | 1-(4-Acetylnaphthalen-1-Yl)Oxybutan-2-One |
|---|---|
| Synonyms | 1-[(4-Acetyl-1-Naphthyl)Oxy]Butan-2-One; 1-(4-Ethanoylnaphthalen-1-Yl)Oxybutan-2-One; (4-Acetyl-1-Naphthoxy)-2-Butanone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 73622-76-1 |
| SMILES | C1=CC=CC2=C(C=CC(=C12)C(C)=O)OCC(CC)=O |
| InChI | 1S/C16H16O3/c1-3-12(18)10-19-16-9-8-13(11(2)17)14-6-4-5-7-15(14)16/h4-9H,3,10H2,1-2H3 |
| InChIKey | NGILSQROLZTVFT-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.312°C at 760 mmHg (Cal.) |
| Flash point | 196.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Acetylnaphthalen-1-Yl)Oxybutan-2-One |