|
CAS#: 73623-09-3 Product: Propan-2-Yl N-Methyl-N-(2-Methylphenyl)Carbamate No suppilers available for the product. |
| Name | Propan-2-Yl N-Methyl-N-(2-Methylphenyl)Carbamate |
|---|---|
| Synonyms | Isopropyl N-Methyl-N-(2-Methylphenyl)Carbamate; N-Methyl-N-(2-Methylphenyl)Carbamic Acid Isopropyl Ester; Carbanilic Acid, N,O-Dimethyl-, Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 73623-09-3 |
| SMILES | C1=C(N(C(OC(C)C)=O)C)C(=CC=C1)C |
| InChI | 1S/C12H17NO2/c1-9(2)15-12(14)13(4)11-8-6-5-7-10(11)3/h5-9H,1-4H3 |
| InChIKey | BSCWAMNSHQSUGC-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.841°C at 760 mmHg (Cal.) |
| Flash point | 121.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl N-Methyl-N-(2-Methylphenyl)Carbamate |