|
CAS#: 73664-36-5 Product: N-(2-Chlorofluoranthen-3-Yl)Acetamide No suppilers available for the product. |
| Name | N-(2-Chlorofluoranthen-3-Yl)Acetamide |
|---|---|
| Synonyms | N-(2-Chloro-3-Fluoranthenyl)Acetamide; N-(2-Chlorofluoranthen-3-Yl)Ethanamide; Acetamide, N-(2-Chloro-3-Fluoranthenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12ClNO |
| Molecular Weight | 293.75 |
| CAS Registry Number | 73664-36-5 |
| SMILES | C1=C3C2=C(C(=C1Cl)NC(C)=O)C=CC=C2C4=CC=CC=C34 |
| InChI | 1S/C18H12ClNO/c1-10(21)20-18-14-8-4-7-13-11-5-2-3-6-12(11)15(17(13)14)9-16(18)19/h2-9H,1H3,(H,20,21) |
| InChIKey | LSNHESLTORWDNG-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.453°C at 760 mmHg (Cal.) |
| Flash point | 285.494°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chlorofluoranthen-3-Yl)Acetamide |