|
CAS#: 73680-87-2 Product: 3-Phenyl-3-Propylazetidin-2-One No suppilers available for the product. |
| Name | 3-Phenyl-3-Propylazetidin-2-One |
|---|---|
| Synonyms | 3-Phenyl-3-Propyl-Azetidin-2-One; 3-Phenyl-3-Propyl-2-Azetidinone; Brn 0158527 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 73680-87-2 |
| SMILES | C2=C(C1(C(=O)NC1)CCC)C=CC=C2 |
| InChI | 1S/C12H15NO/c1-2-8-12(9-13-11(12)14)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | ZUQCGHJXVRJGHS-UHFFFAOYSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.44°C at 760 mmHg (Cal.) |
| Flash point | 214.375°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenyl-3-Propylazetidin-2-One |