|
CAS#: 7369-44-0 Product: N-Hydroxy-N,3-Diphenylacrylamide No suppilers available for the product. |
| Name | N-Hydroxy-N,3-Diphenylacrylamide |
|---|---|
| Synonyms | (E)-N-Hydroxy-N,3-Di(Phenyl)Acrylamide; N-Hydroxy-N,3-Diphenylacrylamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 7369-44-0 |
| EINECS | 230-922-0 |
| SMILES | C1=CC=CC=C1/C=C/C(N(O)C2=CC=CC=C2)=O |
| InChI | 1S/C15H13NO2/c17-15(12-11-13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14/h1-12,18H/b12-11+ |
| InChIKey | TUJGSRKTSYNGAW-VAWYXSNFSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.857°C at 760 mmHg (Cal.) |
| Flash point | 202.884°C (Cal.) |
| (1) | Siping Wei, Bo Liu, Dongbing Zhao, Zhen Wang, Jie Wu, Jingbo Lan and Jingsong You. Pyrido[1,2-c][1,2,4]triazol-3-ylidene: reactivity and its application in organocatalysis and organometallic catalysis, Org. Biomol. Chem., 2009, 7, 4241. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Hydroxy-N,3-Diphenylacrylamide |