| Name | 2,2'-(1,4-Phenylene)Bis(2-Chloropropane) |
|---|---|
| Synonyms | 1,4-Bis(1-Chloro-1-Methyl-Ethyl)Benzene; 1,4-Bis(1-Chloro-1-Methylethyl)Benzene; Benzene, 1,4-Bis(1-Chloro-1-Methylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16Cl2 |
| Molecular Weight | 231.16 |
| CAS Registry Number | 7374-80-3 |
| SMILES | C1=CC(=CC=C1C(Cl)(C)C)C(Cl)(C)C |
| InChI | 1S/C12H16Cl2/c1-11(2,13)9-5-7-10(8-6-9)12(3,4)14/h5-8H,1-4H3 |
| InChIKey | GWRGEEAABGHXBR-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.917°C at 760 mmHg (Cal.) |
| Flash point | 144.434°C (Cal.) |
| (1) | Long-Cheng Gao, Cheng-Long Zhang, Xun Liu, Xing-He Fan, Yi-Xian Wu, Xiao-Fang Chen, Zhihao Shen and Qi-Feng Zhou. ABA type liquid crystalline triblock copolymers by combination of living cationic polymerizaition and ATRP: synthesis and self-assembly, Soft Matter, 2008, 4, 1230. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-(1,4-Phenylene)Bis(2-Chloropropane) |