|
CAS#: 73758-57-3 Product: 2,2-Di(Phenyl)-4-Sulfanylbutanoic Acid No suppilers available for the product. |
| Name | 2,2-Di(Phenyl)-4-Sulfanylbutanoic Acid |
|---|---|
| Synonyms | 2,2-Di(Phenyl)-4-Sulfanyl-Butanoic Acid; 4-Mercapto-2,2-Di(Phenyl)Butanoic Acid; 4-Mercapto-2,2-Di(Phenyl)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.36 |
| CAS Registry Number | 73758-57-3 |
| SMILES | C1=C(C=CC=C1)C(C2=CC=CC=C2)(CCS)C(=O)O |
| InChI | 1S/C16H16O2S/c17-15(18)16(11-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,19H,11-12H2,(H,17,18) |
| InChIKey | ZWILEONEUTXNPU-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.213°C at 760 mmHg (Cal.) |
| Flash point | 175.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Di(Phenyl)-4-Sulfanylbutanoic Acid |