Online Database of Chemicals from Around the World
|
CAS#: 7377-73-3 Product: 4-Methylcholesta-8,24-dien-3-one No suppilers available for the product. |
| Name | 4-Methylcholesta-8,24-dien-3-one |
|---|---|
| Synonyms | 4α-methyl-5α-cholesta-8,24-dien-3-one; CPD-4578 |
| Molecular Structure |  |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.65 |
| CAS Registry Number | 7377-73-3 |
| SMILES | O=C4C(C3C(/C2=C(/C1CCC(C(C)CC\C=C(/C)C)C1(C)CC2)CC3)(C)CC4)C |
| InChI | 1S/C28H44O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h8,19-20,22-24H,7,9-17H2,1-6H3 |
| InChIKey | DBPZYKHQDWKORQ-UHFFFAOYSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.124°C at 760 mmHg (Cal.) |
| Flash point | 204.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylcholesta-8,24-dien-3-one |