|
CAS#: 73771-85-4 Product: 9-(Piperidin-3-Ylmethyl)-9H-Thioxanthene 10-Oxide No suppilers available for the product. |
| Name | 9-(Piperidin-3-Ylmethyl)-9H-Thioxanthene 10-Oxide |
|---|---|
| Synonyms | 9-(3-Piperidylmethyl)-9H-Thioxanthene 10-Oxide; 9-(3-Piperidinylmethyl)-9H-Thioxanthene 10-Oxide; 3-(Thioxanthen-9-Ylmethyl) Piperidine, S-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.44 |
| CAS Registry Number | 73771-85-4 |
| SMILES | C1=CC=CC4=C1C(CC2CNCCC2)C3=C(C=CC=C3)[S]4=O |
| InChI | 1S/C19H21NOS/c21-22-18-9-3-1-7-15(18)17(12-14-6-5-11-20-13-14)16-8-2-4-10-19(16)22/h1-4,7-10,14,17,20H,5-6,11-13H2 |
| InChIKey | REZOITAHOZFCTA-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.833°C at 760 mmHg (Cal.) |
| Flash point | 246.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(Piperidin-3-Ylmethyl)-9H-Thioxanthene 10-Oxide |