|
CAS#: 7378-21-4 Product: N-Acetylhomocysteine No suppilers available for the product. |
| Name | N-Acetylhomocysteine |
|---|---|
| Synonyms | (2S)-2-Acetamido-4-Sulfanyl-Butanoic Acid; (2S)-2-Acetamido-4-Mercaptobutanoic Acid; (2S)-2-Acetamido-4-Mercapto-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 |
| CAS Registry Number | 7378-21-4 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CCS |
| InChI | 1S/C6H11NO3S/c1-4(8)7-5(2-3-11)6(9)10/h5,11H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | REYLLNRLWCBKCM-YFKPBYRVSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.35°C at 760 mmHg (Cal.) |
| Flash point | 216.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetylhomocysteine |