|
CAS#: 73791-44-3 Product: Methyl-(2-Phenylethyl)Arsinic Acid No suppilers available for the product. |
| Name | Methyl-(2-Phenylethyl)Arsinic Acid |
|---|---|
| Synonyms | Arsine Oxide, Hydroxymethylphenethyl-; Methyl(2-Phenylethyl)Arsinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13AsO2 |
| Molecular Weight | 228.12 |
| CAS Registry Number | 73791-44-3 |
| SMILES | C1=CC=CC=C1CC[As](=O)(O)C |
| InChI | 1S/C9H13AsO2/c1-10(11,12)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,11,12) |
| InChIKey | LCSBELKUWOMJII-UHFFFAOYSA-N |
| Boiling point | 388.096°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl-(2-Phenylethyl)Arsinic Acid |