|
CAS#: 73804-81-6 Product: alpha-(Fluoromethyl)Tryptophan No suppilers available for the product. |
| Name | alpha-(Fluoromethyl)Tryptophan |
|---|---|
| Synonyms | 2-Amino-2-(Fluoromethyl)-3-(1H-Indol-3-Yl)Propionic Acid; Fmtrp; Alpha-(Fluoromethyl)Tryptophan |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 |
| CAS Registry Number | 73804-81-6 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)CC(N)(C(=O)O)CF |
| InChI | 1S/C12H13FN2O2/c13-7-12(14,11(16)17)5-8-6-15-10-4-2-1-3-9(8)10/h1-4,6,15H,5,7,14H2,(H,16,17) |
| InChIKey | BZEQVHKJCVLJMC-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.742°C at 760 mmHg (Cal.) |
| Flash point | 242.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Fluoromethyl)Tryptophan |