|
CAS#: 73806-29-8 Product: 2,2,4,4-Tetramethyl-1,3-Cyclobutanediol Bis(Trichloroacetate) No suppilers available for the product. |
| Name | 2,2,4,4-Tetramethyl-1,3-Cyclobutanediol Bis(Trichloroacetate) |
|---|---|
| Synonyms | [2,2,4,4-Tetramethyl-3-(2,2,2-Trichloroacetyl)Oxy-Cyclobutyl] 2,2,2-Trichloroacetate; 2,2,2-Trichloroacetic Acid [2,2,4,4-Tetramethyl-3-(2,2,2-Trichloro-1-Oxoethoxy)Cyclobutyl] Ester; 2,2,2-Trichloroacetic Acid [2,2,4,4-Tetramethyl-3-(2,2,2-Trichloroacetyl)Oxy-Cyclobutyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14Cl6O4 |
| Molecular Weight | 434.96 |
| CAS Registry Number | 73806-29-8 |
| SMILES | CC1(C(C(C1OC(=O)C(Cl)(Cl)Cl)(C)C)OC(=O)C(Cl)(Cl)Cl)C |
| InChI | 1S/C12H14Cl6O4/c1-9(2)5(21-7(19)11(13,14)15)10(3,4)6(9)22-8(20)12(16,17)18/h5-6H,1-4H3 |
| InChIKey | NZRLFFTYTLCMNM-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.581°C at 760 mmHg (Cal.) |
| Flash point | 127.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4-Tetramethyl-1,3-Cyclobutanediol Bis(Trichloroacetate) |