Online Database of Chemicals from Around the World
|
CAS#: 73816-84-9 Product: 3-Chloro-2-Isopentylamino-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 3-Chloro-2-Isopentylamino-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-Chloro-3-(Isopentylamino)Naphthalene-1,4-Dione; 2-Chloro-3-(Isoamylamino)-1,4-Naphthoquinone; 2-Isoamylamino-3-Chloro-1,4-Naphthoquinone |
| Molecular Structure |  |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 |
| CAS Registry Number | 73816-84-9 |
| SMILES | C1=CC=CC2=C1C(=O)C(=C(Cl)C2=O)NCCC(C)C |
| InChI | 1S/C15H16ClNO2/c1-9(2)7-8-17-13-12(16)14(18)10-5-3-4-6-11(10)15(13)19/h3-6,9,17H,7-8H2,1-2H3 |
| InChIKey | MSFVNXVDTMJAMH-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.59°C at 760 mmHg (Cal.) |
| Flash point | 179.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2-Isopentylamino-1,4-Naphthoquinone |