|
CAS#: 73826-13-8 Product: (E)-4-Oxo-4-[1-[3-(Trifluoromethyl)Phenyl]Propan-2-Ylamino]But-2-Enoic Acid No suppilers available for the product. |
| Name | (E)-4-Oxo-4-[1-[3-(Trifluoromethyl)Phenyl]Propan-2-Ylamino]But-2-Enoic Acid |
|---|---|
| Synonyms | (E)-4-[[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]Amino]-4-Oxo-But-2-Enoic Acid; (E)-4-[[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]Amino]-4-Oxobut-2-Enoic Acid; (E)-4-Keto-4-[[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]Amino]But-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 |
| CAS Registry Number | 73826-13-8 |
| SMILES | C1=C(C(F)(F)F)C=CC=C1CC(NC(=O)\C=C\C(=O)O)C |
| InChI | 1S/C14H14F3NO3/c1-9(18-12(19)5-6-13(20)21)7-10-3-2-4-11(8-10)14(15,16)17/h2-6,8-9H,7H2,1H3,(H,18,19)(H,20,21)/b6-5+ |
| InChIKey | GZJNGPZIYDULQU-AATRIKPKSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.695°C at 760 mmHg (Cal.) |
| Flash point | 234.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-Oxo-4-[1-[3-(Trifluoromethyl)Phenyl]Propan-2-Ylamino]But-2-Enoic Acid |