|
CAS#: 73840-32-1 Product: 17-alpha-Hydroxy-Yohimban-16-alpha-carboxylic acid ethyl ester No suppilers available for the product. |
| Name | 17-alpha-Hydroxy-Yohimban-16-alpha-carboxylic acid ethyl ester |
|---|---|
| Synonyms | A 38; Brn 6119015; Yohimban-16-Alpha-Carboxylic Acid, 17-Alpha-Hydroxy-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.47 |
| CAS Registry Number | 73840-32-1 |
| SMILES | [C@H]13C4=C(CCN1C[C@@H]2CC[C@@H]([C@@H]([C@H]2C3)C(=O)OCC)O)C5=C([NH]4)C=CC=C5 |
| InChI | 1S/C22H28N2O3/c1-2-27-22(26)20-16-11-18-21-15(14-5-3-4-6-17(14)23-21)9-10-24(18)12-13(16)7-8-19(20)25/h3-6,13,16,18-20,23,25H,2,7-12H2,1H3/t13-,16-,18-,19-,20+/m0/s1 |
| InChIKey | ZYVPSCRTENVKPN-ZQCVIMGFSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.82°C at 760 mmHg (Cal.) |
| Flash point | 287.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-alpha-Hydroxy-Yohimban-16-alpha-carboxylic acid ethyl ester |