|
CAS#: 7385-98-0 Product: 4-(2-Pyridylazo)Naphthol No suppilers available for the product. |
| Name | 4-(2-Pyridylazo)Naphthol |
|---|---|
| Synonyms | (4E)-4-(2-Pyridylhydrazono)Naphthalen-1-One; (4E)-4-(2-Pyridylhydrazono)-1-Naphthalenone; 1-Naphthalenol, 4-(2-Pyridinylazo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 |
| CAS Registry Number | 7385-98-0 |
| SMILES | C1=C/2C(=CC=C1)C(=O)C=CC2=N/NC3=CC=CC=N3 |
| InChI | 1S/C15H11N3O/c19-14-9-8-13(11-5-1-2-6-12(11)14)17-18-15-7-3-4-10-16-15/h1-10H,(H,16,18)/b17-13+ |
| InChIKey | ULNUDGLDCRAHJC-GHRIWEEISA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.996°C at 760 mmHg (Cal.) |
| Flash point | 213.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Pyridylazo)Naphthol |