|
CAS#: 73855-53-5 Product: 3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoic Acid No suppilers available for the product. |
| Name | 3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoic Acid |
|---|---|
| Synonyms | 3,5-Dichloro-2,6-Dihydroxy-4-Methyl-Benzoic Acid; 3,5-Dichloro-4-Methyl-2,6-Dihydroxybenzoic Acid; Benzoic Acid, 3,5-Dichloro-2,6-Dihydroxy-4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl2O4 |
| Molecular Weight | 237.04 |
| CAS Registry Number | 73855-53-5 |
| SMILES | CC1=C(Cl)C(=C(C(=C1Cl)O)C(=O)O)O |
| InChI | 1S/C8H6Cl2O4/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h11-12H,1H3,(H,13,14) |
| InChIKey | FFCAQFQHJFUVPZ-UHFFFAOYSA-N |
| Density | 1.705g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.029°C at 760 mmHg (Cal.) |
| Flash point | 172.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-2,6-Dihydroxy-4-Methylbenzoic Acid |