|
CAS#: 738609-39-7 Product: 6-Chloro-5,6-dihydroimidazo[1,5-a]pyrido[3,2-e]pyrazine No suppilers available for the product. |
| Name | 6-Chloro-5,6-dihydroimidazo[1,5-a]pyrido[3,2-e]pyrazine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H7ClN4 |
| Molecular Weight | 206.63 |
| CAS Registry Number | 738609-39-7 |
| SMILES | C1=CC2=C(N=C1)N3C=NC=C3C(N2)Cl |
| InChI | 1S/C9H7ClN4/c10-8-7-4-11-5-14(7)9-6(13-8)2-1-3-12-9/h1-5,8,13H |
| InChIKey | JYLJGMFDKNFMNM-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 230.4±28.7°C (Cal.) |
| Refractive index | 1.803 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-5,6-dihydroimidazo[1,5-a]pyrido[3,2-e]pyrazine |