|
CAS#: 73908-84-6 Product: 1,3-Dimethyl-8-Propylsulfanyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 1,3-Dimethyl-8-Propylsulfanyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 1,3-Dimethyl-8-(Propylthio)-7H-Purine-2,6-Dione; 1,3-Dimethyl-8-(Propylthio)-7H-Purine-2,6-Quinone; Theophylline, (8-Propylthio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 |
| CAS Registry Number | 73908-84-6 |
| SMILES | C(SC2=NC1=C(C(N(C)C(N1C)=O)=O)[NH]2)CC |
| InChI | 1S/C10H14N4O2S/c1-4-5-17-9-11-6-7(12-9)13(2)10(16)14(3)8(6)15/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | RFPGEDDGVUAZQE-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.347°C at 760 mmHg (Cal.) |
| Flash point | 238.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-8-Propylsulfanyl-7H-Purine-2,6-Dione |