|
CAS#: 73927-02-3 Product: 3-Methylidene-1-(3-Methylphenyl)Pyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | 3-Methylidene-1-(3-Methylphenyl)Pyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 3-Methylene-1-(3-Methylphenyl)Pyrrolidine-2,5-Dione; 3-Methylene-1-(3-Methylphenyl)Pyrrolidine-2,5-Quinone; Itaconimide, N-(3-Methylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 |
| CAS Registry Number | 73927-02-3 |
| SMILES | C1=C(C=CC=C1N2C(=O)C(CC2=O)=C)C |
| InChI | 1S/C12H11NO2/c1-8-4-3-5-10(6-8)13-11(14)7-9(2)12(13)15/h3-6H,2,7H2,1H3 |
| InChIKey | JECILGQKPWXJCI-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.79°C at 760 mmHg (Cal.) |
| Flash point | 152.882°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylidene-1-(3-Methylphenyl)Pyrrolidine-2,5-Dione |