|
CAS#: 73931-88-1 Product: 2-(1H-Imidazol-1-Yl)-1-[4-(2-Phenylethyl)Phenyl]Ethan-1-One No suppilers available for the product. |
| Name | 2-(1H-Imidazol-1-Yl)-1-[4-(2-Phenylethyl)Phenyl]Ethan-1-One |
|---|---|
| Synonyms | 2-(1-Imidazolyl)-1-[4-(2-Phenylethyl)Phenyl]Ethanone; Brn 5077347 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.36 |
| CAS Registry Number | 73931-88-1 |
| EINECS | 277-640-4 |
| SMILES | C2=C(C(C[N]1C=CN=C1)=O)C=CC(=C2)CCC3=CC=CC=C3 |
| InChI | 1S/C19H18N2O/c22-19(14-21-13-12-20-15-21)18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-5,8-13,15H,6-7,14H2 |
| InChIKey | FHCUFTBEPZKVMR-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.291°C at 760 mmHg (Cal.) |
| Flash point | 256.972°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1H-Imidazol-1-Yl)-1-[4-(2-Phenylethyl)Phenyl]Ethan-1-One |