|
CAS#: 73943-10-9 Product: 9-Chloro-3-Methyl-1,2,4,5-Tetrahydro-3-Benzazepine No suppilers available for the product. |
| Name | 9-Chloro-3-Methyl-1,2,4,5-Tetrahydro-3-Benzazepine |
|---|---|
| Synonyms | Pdsp1_000725; C10970; Sk&F 86466 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 |
| CAS Registry Number | 73943-10-9 |
| SMILES | C1=CC=C(Cl)C2=C1CCN(CC2)C |
| InChI | 1S/C11H14ClN/c1-13-7-5-9-3-2-4-11(12)10(9)6-8-13/h2-4H,5-8H2,1H3 |
| InChIKey | RSRUDTPYRBLHEO-UHFFFAOYSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.07°C at 760 mmHg (Cal.) |
| Flash point | 128.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Chloro-3-Methyl-1,2,4,5-Tetrahydro-3-Benzazepine |