|
CAS#: 7395-90-6 Product: Indriline No suppilers available for the product. |
| Name | Indriline |
|---|---|
| Synonyms | N,N-Dimethyl-2-(1-Phenyl-1-Indenyl)Ethanamine; Dimethyl-[2-(1-Phenylinden-1-Yl)Ethyl]Amine; Nsc169093 (Hydrochloride) |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 |
| CAS Registry Number | 7395-90-6 |
| SMILES | C1=CC=CC3=C1C(C2=CC=CC=C2)(C=C3)CCN(C)C |
| InChI | 1S/C19H21N/c1-20(2)15-14-19(17-9-4-3-5-10-17)13-12-16-8-6-7-11-18(16)19/h3-13H,14-15H2,1-2H3 |
| InChIKey | KAQPNQMPHIRKJJ-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.899°C at 760 mmHg (Cal.) |
| Flash point | 158.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indriline |