|
CAS#: 73953-66-9 Product: 1-(3-Bromophenyl)-3-(2H-1,2,4-Triazol-3-Yl)Thiourea No suppilers available for the product. |
| Name | 1-(3-Bromophenyl)-3-(2H-1,2,4-Triazol-3-Yl)Thiourea |
|---|---|
| Synonyms | 1-(M-Bromophenyl)-3-(3-(1H-1,2,4-Triazolyl))-2-Thiourea; Urea, 1-(M-Bromophenyl)-2-Thio-3-(1H-1,2,4-Triazol-3-Yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8BrN5S |
| Molecular Weight | 298.16 |
| CAS Registry Number | 73953-66-9 |
| SMILES | C1=C(Br)C=CC=C1NC(=S)NC2=NC=N[NH]2 |
| InChI | 1S/C9H8BrN5S/c10-6-2-1-3-7(4-6)13-9(16)14-8-11-5-12-15-8/h1-5H,(H3,11,12,13,14,15,16) |
| InChIKey | GIEDKLOFTJWEST-UHFFFAOYSA-N |
| Density | 1.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.128°C at 760 mmHg (Cal.) |
| Flash point | 228.449°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Bromophenyl)-3-(2H-1,2,4-Triazol-3-Yl)Thiourea |