|
CAS#: 73972-56-2 Product: 6-(2,2,2-Trifluoroethoxy)-7H-Purine No suppilers available for the product. |
| Name | 6-(2,2,2-Trifluoroethoxy)-7H-Purine |
|---|---|
| Synonyms | 1H-Purine, 6-(2,2,2-Trifluoroethoxy)- (9Ci); Nsc 29411; 1H-Purine, 6-(2,2,2-Trifluoroethoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5F3N4O |
| Molecular Weight | 218.14 |
| CAS Registry Number | 73972-56-2 |
| SMILES | C1=NC2=C(C(=N1)OCC(F)(F)F)[NH]C=N2 |
| InChI | 1S/C7H5F3N4O/c8-7(9,10)1-15-6-4-5(12-2-11-4)13-3-14-6/h2-3H,1H2,(H,11,12,13,14) |
| InChIKey | DIWYLTCCAAMWNB-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.366°C at 760 mmHg (Cal.) |
| Flash point | 190.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2,2,2-Trifluoroethoxy)-7H-Purine |