|
CAS#: 73972-89-1 Product: 2-(2-Iodoacetyl)-3-Methylphthalazine-1,4-Dione No suppilers available for the product. |
| Name | 2-(2-Iodoacetyl)-3-Methylphthalazine-1,4-Dione |
|---|---|
| Synonyms | 2-(2-Iodoacetyl)-3-Methyl-Phthalazine-1,4-Dione; 2-(2-Iodo-1-Oxoethyl)-3-Methylphthalazine-1,4-Dione; 2-(2-Iodoacetyl)-3-Methyl-Phthalazine-1,4-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9IN2O3 |
| Molecular Weight | 344.11 |
| CAS Registry Number | 73972-89-1 |
| SMILES | C1=CC=CC2=C1C(=O)N(N(C2=O)C)C(=O)CI |
| InChI | 1S/C11H9IN2O3/c1-13-10(16)7-4-2-3-5-8(7)11(17)14(13)9(15)6-12/h2-5H,6H2,1H3 |
| InChIKey | AHHZZYNMXBMHKT-UHFFFAOYSA-N |
| Density | 1.896g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.066°C at 760 mmHg (Cal.) |
| Flash point | 212.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Iodoacetyl)-3-Methylphthalazine-1,4-Dione |