|
CAS#: 73986-56-8 Product: (2-Iodophenyl) 3,4,5-Triiodobenzoate No suppilers available for the product. |
| Name | (2-Iodophenyl) 3,4,5-Triiodobenzoate |
|---|---|
| Synonyms | 3,4,5-Triiodobenzoic Acid (2-Iodophenyl) Ester; 3,4,5-Triiodobenzoic Acid O-Iodophenyl Ester; Benzoic Acid, 3,4,5-Triiodo-, 2-Iodophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H6I4O2 |
| Molecular Weight | 701.81 |
| CAS Registry Number | 73986-56-8 |
| SMILES | C1=C(C(=C(C=C1C(OC2=CC=CC=C2I)=O)I)I)I |
| InChI | 1S/C13H6I4O2/c14-8-3-1-2-4-11(8)19-13(18)7-5-9(15)12(17)10(16)6-7/h1-6H |
| InChIKey | IHENPGBTLOVCMW-UHFFFAOYSA-N |
| Density | 2.687g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.94°C at 760 mmHg (Cal.) |
| Flash point | 325.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Iodophenyl) 3,4,5-Triiodobenzoate |