|
CAS#: 73986-92-2 Product: Dihydroergosine Tartrate No suppilers available for the product. |
| Name | Dihydroergosine Tartrate |
|---|---|
| Synonyms | Ergosine, Dihydro-, Tartrate |
| Molecular Structure | ![]() |
| Molecular Formula | C34H45N5O11 |
| Molecular Weight | 699.76 |
| CAS Registry Number | 73986-92-2 |
| SMILES | [C@]56(O[C@@](NC(=O)[C@@H]1C[C@H]2[C@H](N(C1)C)CC3=C[NH]C4=CC=CC2=C34)(C(=O)N5[C@H](C(=O)N7[C@H]6CCC7)CC(C)C)C)O.[C@@H](O)([C@@H](O)C(=O)O)C(=O)O |
| InChI | 1S/C30H39N5O5.C4H6O6/c1-16(2)11-23-27(37)34-10-6-9-24(34)30(39)35(23)28(38)29(3,40-30)32-26(36)18-12-20-19-7-5-8-21-25(19)17(14-31-21)13-22(20)33(4)15-18;5-1(3(7)8)2(6)4(9)10/h5,7-8,14,16,18,20,22-24,31,39H,6,9-13,15H2,1-4H3,(H,32,36);1-2,5-6H,(H,7,8)(H,9,10)/t18-,20-,22-,23+,24+,29-,30+;1-,2-/m11/s1 |
| InChIKey | UDPYRBOUPWEPSB-XPCIGUNVSA-N |
| Boiling point | 846.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydroergosine Tartrate |